C52H96N16 — CID 91204529
5,14,23,32-tetrakis(4-methylpiperazin-1-yl)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 91204529) has the molecular formula C52H96N16 and a molecular weight of 945.45 g/mol. Its IUPAC name is 5,14,23,32-tetrakis(4-methylpiperazin-1-yl)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 5,14,23,32-tetrakis(4-methylpiperazin-1-yl)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 91204529 |
| Molecular Formula | C52H96N16 |
| Molecular Weight | 945.45 g/mol |
| Exact Mass | 944.80 |
| IUPAC Name | 5,14,23,32-tetrakis(4-methylpiperazin-1-yl)-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | CN1CCN(C2CCCC3C4NC(NC5NC(NC6NC(NC7NC(N4)C4C7CCCC4N4CCN(C)CC4)C4C6CCCC4N4CCN(C)CC4)C4C5CCCC4N4CCN(C)CC4)C32)CC1 |
| InChI | InChI=1S/C52H96N16/c1-61-17-25-65(26-18-61)37-13-5-9-33-41(37)49-53-45(33)58-50-43-35(11-7-15-39(43)67-29-21-63(3)22-30-67)47(55-50)60-52-44-36(12-8-16-40(44)68-31-23-64(4)24-32-68)48(56-52)59-51-42-34(46(54-51)57-49)10-6-14-38(42)66-27-19-62(2)20-28-66/h33-60H,5-32H2,1-4H3 |
| InChIKey | YKIPZNKRKMORKB-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.45 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |