C22H31ClO3 — CID 91204999
7-[(1R,2R,5S)-2-[(3S)-4-(4-chlorophenyl)-3-hydroxybut-1-enyl]-5-hydroxycyclopentyl]heptanal (PubChem CID 91204999) has the molecular formula C22H31ClO3 and a molecular weight of 378.94 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-2-[(3S)-4-(4-chlorophenyl)-3-hydroxybut-1-enyl]-5-hydroxycyclopentyl]heptanal.
| Compound Name | 7-[(1R,2R,5S)-2-[(3S)-4-(4-chlorophenyl)-3-hydroxybut-1-enyl]-5-hydroxycyclopentyl]heptanal |
|---|---|
| PubChem CID | 91204999 |
| Molecular Formula | C22H31ClO3 |
| Molecular Weight | 378.94 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 7-[(1R,2R,5S)-2-[(3S)-4-(4-chlorophenyl)-3-hydroxybut-1-enyl]-5-hydroxycyclopentyl]heptanal |
| SMILES | O=CCCCCCC[C@H]1[C@@H](O)CC[C@@H]1C=C[C@@H](O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H31ClO3/c23-19-11-7-17(8-12-19)16-20(25)13-9-18-10-14-22(26)21(18)6-4-2-1-3-5-15-24/h7-9,11-13,15,18,20-22,25-26H,1-6,10,14,16H2/t18-,20+,21+,22-/m0/s1 |
| InChIKey | JTRIVFIFDHXPQC-PDGJWGCVSA-N |
| XLogP | 4.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.94 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|