C29H37ClN2O10 — CID 91206159
2,2-dimethylpropanoyl chloride;(E)-3-(5-nitrocyclohexen-1-yl)prop-2-enoic acid;[(2R)-5-oxohex-3-yn-2-yl] (E)-3-(5-nitrocyclohexen-1-yl)prop-2-enoate (PubChem CID 91206159) has the molecular formula C29H37ClN2O10 and a molecular weight of 609.07 g/mol. Its IUPAC name is 2,2-dimethylpropanoyl chloride;(E)-3-(5-nitrocyclohexen-1-yl)prop-2-enoic acid;[(2R)-5-oxohex-3-yn-2-yl] (E)-3-(5-nitrocyclohexen-1-yl)prop-2-enoate.
| Compound Name | 2,2-dimethylpropanoyl chloride;(E)-3-(5-nitrocyclohexen-1-yl)prop-2-enoic acid;[(2R)-5-oxohex-3-yn-2-yl] (E)-3-(5-nitrocyclohexen-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 91206159 |
| Molecular Formula | C29H37ClN2O10 |
| Molecular Weight | 609.07 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | 2,2-dimethylpropanoyl chloride;(E)-3-(5-nitrocyclohexen-1-yl)prop-2-enoic acid;[(2R)-5-oxohex-3-yn-2-yl] (E)-3-(5-nitrocyclohexen-1-yl)prop-2-enoate |
| SMILES | CC(=O)C#C[C@@H](C)OC(=O)/C=C/C1=CCCC([N+](=O)[O-])C1.CC(C)(C)C(=O)Cl.O=C(O)/C=C/C1=CCCC([N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H17NO5.C9H11NO4.C5H9ClO/c1-11(17)6-7-12(2)21-15(18)9-8-13-4-3-5-14(10-13)16(19)20;11-9(12)5-4-7-2-1-3-8(6-7)10(13)14;1-5(2,3)4(6)7/h4,8-9,12,14H,3,5,10H2,1-2H3;2,4-5,8H,1,3,6H2,(H,11,12);1-3H3/b9-8+;5-4+;/t12-,14?;;/m1../s1 |
| InChIKey | YJSQCBQVDWYZGC-GYLHDKJDSA-N |
| XLogP | 5.00 |
| TPSA | 184.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.07 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|