C26H36Cl2N2O5S — CID 91206194
3-(6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl)-N-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]benzenesulfonamide (PubChem CID 91206194) has the molecular formula C26H36Cl2N2O5S and a molecular weight of 559.56 g/mol. Its IUPAC name is 3-(6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl)-N-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]benzenesulfonamide.
| Compound Name | 3-(6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl)-N-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91206194 |
| Molecular Formula | C26H36Cl2N2O5S |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 3-(6,8-dichloro-2-ethyl-3,4-dihydro-1H-isoquinolin-4-yl)-N-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]benzenesulfonamide |
| SMILES | CCCOCCOCCOCCNS(=O)(=O)c1cccc(C2CN(CC)Cc3c(Cl)cc(Cl)cc32)c1 |
| InChI | InChI=1S/C26H36Cl2N2O5S/c1-3-9-33-11-13-35-14-12-34-10-8-29-36(31,32)22-7-5-6-20(15-22)24-18-30(4-2)19-25-23(24)16-21(27)17-26(25)28/h5-7,15-17,24,29H,3-4,8-14,18-19H2,1-2H3 |
| InChIKey | IBGHNIHGRAPMDF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|