C19H25FN4O5S — CID 91206587
N-(2-acetamidoethyl)-8-(5-fluoro-2-methylphenyl)sulfonyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide (PubChem CID 91206587) has the molecular formula C19H25FN4O5S and a molecular weight of 440.50 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-8-(5-fluoro-2-methylphenyl)sulfonyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-8-(5-fluoro-2-methylphenyl)sulfonyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 91206587 |
| Molecular Formula | C19H25FN4O5S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-(2-acetamidoethyl)-8-(5-fluoro-2-methylphenyl)sulfonyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide |
| SMILES | CC(=O)NCCNC(=O)C1=CC2(CCN(S(=O)(=O)c3cc(F)ccc3C)CC2)ON1 |
| InChI | InChI=1S/C19H25FN4O5S/c1-13-3-4-15(20)11-17(13)30(27,28)24-9-5-19(6-10-24)12-16(23-29-19)18(26)22-8-7-21-14(2)25/h3-4,11-12,23H,5-10H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | RIQCJVUUGLRGHX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|