About 1-(2-cyclohexylethyl)-4-propylpiperazine;ethane;N-hydroxybenzamide
1-(2-cyclohexylethyl)-4-propylpiperazine;ethane;N-hydroxybenzamide (PubChem CID 91207184) has the molecular formula C24H43N3O2
and a molecular weight of 405.63 g/mol. Its IUPAC name is 1-(2-cyclohexylethyl)-4-propylpiperazine;ethane;N-hydroxybenzamide.
Molecular Properties
| Compound Name | 1-(2-cyclohexylethyl)-4-propylpiperazine;ethane;N-hydroxybenzamide |
| PubChem CID | 91207184 |
| Molecular Formula | C24H43N3O2 |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.34 |
| IUPAC Name | 1-(2-cyclohexylethyl)-4-propylpiperazine;ethane;N-hydroxybenzamide |
| SMILES | CC.CCCN1CCN(CCC2CCCCC2)CC1.O=C(NO)c1ccccc1 |
| InChI | InChI=1S/C15H30N2.C7H7NO2.C2H6/c1-2-9-16-11-13-17(14-12-16)10-8-15-6-4-3-5-7-15;9-7(8-10)6-4-2-1-3-5-6;1-2/h15H,2-14H2,1H3;1-5,10H,(H,8,9);1-2H3 |
| InChIKey | SVFXFJUDVLIQBV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-cyclohexylethyl)-4-propylpiperazine;ethane;N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclohexylethyl)-4-propylpiperazine;ethane;N-hydroxybenzamide?
The IUPAC name of 1-(2-cyclohexylethyl)-4-propylpiperazine;ethane;N-hydroxybenzamide (CID 91207184) is 1-(2-cyclohexylethyl)-4-propylpiperazine;ethane;N-hydroxybenzamide.
What is the SMILES notation for 1-(2-cyclohexylethyl)-4-propylpiperazine;ethane;N-hydroxybenzamide?
The canonical SMILES for 1-(2-cyclohexylethyl)-4-propylpiperazine;ethane;N-hydroxybenzamide is CC.CCCN1CCN(CCC2CCCCC2)CC1.O=C(NO)c1ccccc1.
What is the InChIKey of 1-(2-cyclohexylethyl)-4-propylpiperazine;ethane;N-hydroxybenzamide?
The InChIKey is SVFXFJUDVLIQBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2.C7H7NO2.C2H6/c1-2-9-16-11-13-17(14-12-16)10-8-15-6-4-3-5-7-15;9-7(8-10)6-4-2-1-3-5-6;1-2/h15H,2-14H2,1H3;1-5,10H,(H,8,9);1-2H3.
What are the key properties of 1-(2-cyclohexylethyl)-4-propylpiperazine;ethane;N-hydroxybenzamide?
1-(2-cyclohexylethyl)-4-propylpiperazine;ethane;N-hydroxybenzamide has a molecular weight of 405.63 g/mol, XLogP of 4.82, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclohexylethyl)-4-propylpiperazine;ethane;N-hydroxybenzamide is sourced from PubChem (CID 91207184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).