C5H9N5 — CID 91207664
3,4,5-triiminocyclopentane-1,2-diamine (PubChem CID 91207664) has the molecular formula C5H9N5 and a molecular weight of 139.16 g/mol. Its IUPAC name is 3,4,5-triiminocyclopentane-1,2-diamine.
| Compound Name | 3,4,5-triiminocyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 91207664 |
| Molecular Formula | C5H9N5 |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.09 |
| IUPAC Name | 3,4,5-triiminocyclopentane-1,2-diamine |
| SMILES | [H]N=C1/C(=N\[H])C(N)C(N)/C1=N/[H] |
| InChI | InChI=1S/C5H9N5/c6-1-2(7)4(9)5(10)3(1)8/h1-2,8-10H,6-7H2/b8-3-,9-4-,10-5? |
| InChIKey | MJRJAGKMDVLIDR-PVOVDAGSSA-N |
| XLogP | -1.29 |
| TPSA | 123.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|