C23H24F6O5S — CID 91207957
[(3S,4R,5R)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-phenyloxan-3-yl]methyl methanesulfonate (PubChem CID 91207957) has the molecular formula C23H24F6O5S and a molecular weight of 526.50 g/mol. Its IUPAC name is [(3S,4R,5R)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-phenyloxan-3-yl]methyl methanesulfonate.
| Compound Name | [(3S,4R,5R)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-phenyloxan-3-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 91207957 |
| Molecular Formula | C23H24F6O5S |
| Molecular Weight | 526.50 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | [(3S,4R,5R)-5-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-phenyloxan-3-yl]methyl methanesulfonate |
| SMILES | C[C@@H](O[C@H]1COC[C@@H](COS(C)(=O)=O)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H24F6O5S/c1-14(16-8-18(22(24,25)26)10-19(9-16)23(27,28)29)34-20-13-32-11-17(12-33-35(2,30)31)21(20)15-6-4-3-5-7-15/h3-10,14,17,20-21H,11-13H2,1-2H3/t14-,17+,20+,21?/m1/s1 |
| InChIKey | SISGKCYRTDTDLS-MWUPSAKLSA-N |
| XLogP | 5.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|