C27H46F6O3Si — CID 91208141
(1R,4S,7aR)-7a-methyl-1-[1,1,1-trifluoro-2-hydroxy-6,10-dimethyl-2-(trifluoromethyl)-10-trimethylsilyloxyundec-3-en-6-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 91208141) has the molecular formula C27H46F6O3Si and a molecular weight of 560.74 g/mol. Its IUPAC name is (1R,4S,7aR)-7a-methyl-1-[1,1,1-trifluoro-2-hydroxy-6,10-dimethyl-2-(trifluoromethyl)-10-trimethylsilyloxyundec-3-en-6-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,4S,7aR)-7a-methyl-1-[1,1,1-trifluoro-2-hydroxy-6,10-dimethyl-2-(trifluoromethyl)-10-trimethylsilyloxyundec-3-en-6-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 91208141 |
| Molecular Formula | C27H46F6O3Si |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | (1R,4S,7aR)-7a-methyl-1-[1,1,1-trifluoro-2-hydroxy-6,10-dimethyl-2-(trifluoromethyl)-10-trimethylsilyloxyundec-3-en-6-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | CC(C)(CCCC(C)(CC=CC(O)(C(F)(F)F)C(F)(F)F)[C@H]1CCC2[C@@H](O)CCC[C@@]21C)O[Si](C)(C)C |
| InChI | InChI=1S/C27H46F6O3Si/c1-22(2,36-37(5,6)7)14-9-15-23(3,16-10-18-25(35,26(28,29)30)27(31,32)33)21-13-12-19-20(34)11-8-17-24(19,21)4/h10,18-21,34-35H,8-9,11-17H2,1-7H3/t19?,20-,21+,23?,24-/m0/s1 |
| InChIKey | MVRBHHXBWWYHHM-SJFJGFQUSA-N |
| XLogP | 8.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|