C14H22 — CID 91208740
5,6-diethyl-2-methyl-4,5,6,7-tetrahydro-3aH-indene (PubChem CID 91208740) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 5,6-diethyl-2-methyl-4,5,6,7-tetrahydro-3aH-indene.
| Compound Name | 5,6-diethyl-2-methyl-4,5,6,7-tetrahydro-3aH-indene |
|---|---|
| PubChem CID | 91208740 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 5,6-diethyl-2-methyl-4,5,6,7-tetrahydro-3aH-indene |
| SMILES | CCC1CC2=CC(C)=CC2CC1CC |
| InChI | InChI=1S/C14H22/c1-4-11-8-13-6-10(3)7-14(13)9-12(11)5-2/h6-7,11-13H,4-5,8-9H2,1-3H3 |
| InChIKey | YSUULCCYHYXSRG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |