About 2-(1-methyl-3-phenylpyrazol-4-yl)-1,3-oxazole;nitromethane
2-(1-methyl-3-phenylpyrazol-4-yl)-1,3-oxazole;nitromethane (PubChem CID 91208762) has the molecular formula C14H14N4O3
and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-(1-methyl-3-phenylpyrazol-4-yl)-1,3-oxazole;nitromethane.
Molecular Properties
| Compound Name | 2-(1-methyl-3-phenylpyrazol-4-yl)-1,3-oxazole;nitromethane |
| PubChem CID | 91208762 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-(1-methyl-3-phenylpyrazol-4-yl)-1,3-oxazole;nitromethane |
| SMILES | C[N+](=O)[O-].Cn1cc(-c2ncco2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C13H11N3O.CH3NO2/c1-16-9-11(13-14-7-8-17-13)12(15-16)10-5-3-2-4-6-10;1-2(3)4/h2-9H,1H3;1H3 |
| InChIKey | VEBVBEIRDRLVGX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 86.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methyl-3-phenylpyrazol-4-yl)-1,3-oxazole;nitromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyl-3-phenylpyrazol-4-yl)-1,3-oxazole;nitromethane?
The IUPAC name of 2-(1-methyl-3-phenylpyrazol-4-yl)-1,3-oxazole;nitromethane (CID 91208762) is 2-(1-methyl-3-phenylpyrazol-4-yl)-1,3-oxazole;nitromethane.
What is the SMILES notation for 2-(1-methyl-3-phenylpyrazol-4-yl)-1,3-oxazole;nitromethane?
The canonical SMILES for 2-(1-methyl-3-phenylpyrazol-4-yl)-1,3-oxazole;nitromethane is C[N+](=O)[O-].Cn1cc(-c2ncco2)c(-c2ccccc2)n1.
What is the InChIKey of 2-(1-methyl-3-phenylpyrazol-4-yl)-1,3-oxazole;nitromethane?
The InChIKey is VEBVBEIRDRLVGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O.CH3NO2/c1-16-9-11(13-14-7-8-17-13)12(15-16)10-5-3-2-4-6-10;1-2(3)4/h2-9H,1H3;1H3.
What are the key properties of 2-(1-methyl-3-phenylpyrazol-4-yl)-1,3-oxazole;nitromethane?
2-(1-methyl-3-phenylpyrazol-4-yl)-1,3-oxazole;nitromethane has a molecular weight of 286.29 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-3-phenylpyrazol-4-yl)-1,3-oxazole;nitromethane is sourced from PubChem (CID 91208762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).