C16H20ClN5O4 — CID 91208795
2-(4-chloro-1,3,5-triazin-2-yl)-3,4-dimethoxy-5-(morpholin-4-ylmethoxy)aniline (PubChem CID 91208795) has the molecular formula C16H20ClN5O4 and a molecular weight of 381.82 g/mol. Its IUPAC name is 2-(4-chloro-1,3,5-triazin-2-yl)-3,4-dimethoxy-5-(morpholin-4-ylmethoxy)aniline.
| Compound Name | 2-(4-chloro-1,3,5-triazin-2-yl)-3,4-dimethoxy-5-(morpholin-4-ylmethoxy)aniline |
|---|---|
| PubChem CID | 91208795 |
| Molecular Formula | C16H20ClN5O4 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-(4-chloro-1,3,5-triazin-2-yl)-3,4-dimethoxy-5-(morpholin-4-ylmethoxy)aniline |
| SMILES | COc1c(OCN2CCOCC2)cc(N)c(-c2ncnc(Cl)n2)c1OC |
| InChI | InChI=1S/C16H20ClN5O4/c1-23-13-11(26-9-22-3-5-25-6-4-22)7-10(18)12(14(13)24-2)15-19-8-20-16(17)21-15/h7-8H,3-6,9,18H2,1-2H3 |
| InChIKey | TWISJFMOXXXNHP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|