About 6-prop-2-ynoxyhexanamide
6-prop-2-ynoxyhexanamide (PubChem CID 91208920) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is 6-prop-2-ynoxyhexanamide.
Molecular Properties
| Compound Name | 6-prop-2-ynoxyhexanamide |
| PubChem CID | 91208920 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 6-prop-2-ynoxyhexanamide |
| SMILES | C#CCOCCCCCC(N)=O |
| InChI | InChI=1S/C9H15NO2/c1-2-7-12-8-5-3-4-6-9(10)11/h1H,3-8H2,(H2,10,11) |
| InChIKey | OMVIQBQWIVJJDV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-prop-2-ynoxyhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-prop-2-ynoxyhexanamide?
The IUPAC name of 6-prop-2-ynoxyhexanamide (CID 91208920) is 6-prop-2-ynoxyhexanamide.
What is the SMILES notation for 6-prop-2-ynoxyhexanamide?
The canonical SMILES for 6-prop-2-ynoxyhexanamide is C#CCOCCCCCC(N)=O.
What is the InChIKey of 6-prop-2-ynoxyhexanamide?
The InChIKey is OMVIQBQWIVJJDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-2-7-12-8-5-3-4-6-9(10)11/h1H,3-8H2,(H2,10,11).
What are the key properties of 6-prop-2-ynoxyhexanamide?
6-prop-2-ynoxyhexanamide has a molecular weight of 169.22 g/mol, XLogP of 0.68, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-prop-2-ynoxyhexanamide is sourced from PubChem (CID 91208920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).