About 1-aminoethyl N-hexylcarbamate
1-aminoethyl N-hexylcarbamate (PubChem CID 91209300) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-aminoethyl N-hexylcarbamate.
Molecular Properties
| Compound Name | 1-aminoethyl N-hexylcarbamate |
| PubChem CID | 91209300 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 1-aminoethyl N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)OC(C)N |
| InChI | InChI=1S/C9H20N2O2/c1-3-4-5-6-7-11-9(12)13-8(2)10/h8H,3-7,10H2,1-2H3,(H,11,12) |
| InChIKey | XRBVQHYQGGYTBX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethyl N-hexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethyl N-hexylcarbamate?
The IUPAC name of 1-aminoethyl N-hexylcarbamate (CID 91209300) is 1-aminoethyl N-hexylcarbamate.
What is the SMILES notation for 1-aminoethyl N-hexylcarbamate?
The canonical SMILES for 1-aminoethyl N-hexylcarbamate is CCCCCCNC(=O)OC(C)N.
What is the InChIKey of 1-aminoethyl N-hexylcarbamate?
The InChIKey is XRBVQHYQGGYTBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2/c1-3-4-5-6-7-11-9(12)13-8(2)10/h8H,3-7,10H2,1-2H3,(H,11,12).
What are the key properties of 1-aminoethyl N-hexylcarbamate?
1-aminoethyl N-hexylcarbamate has a molecular weight of 188.27 g/mol, XLogP of 1.60, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethyl N-hexylcarbamate is sourced from PubChem (CID 91209300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).