C15H18ClN5 — CID 91209458
N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]pyrimidin-2-amine (PubChem CID 91209458) has the molecular formula C15H18ClN5 and a molecular weight of 303.80 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]pyrimidin-2-amine.
| Compound Name | N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 91209458 |
| Molecular Formula | C15H18ClN5 |
| Molecular Weight | 303.80 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]pyrimidin-2-amine |
| SMILES | Clc1ccc(CN2CCN(Nc3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C15H18ClN5/c16-14-4-2-13(3-5-14)12-20-8-10-21(11-9-20)19-15-17-6-1-7-18-15/h1-7H,8-12H2,(H,17,18,19) |
| InChIKey | XXDGFSUUJKBVDV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.80 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |