About 1-methoxy-3-(propylamino)hexan-2-one;propan-1-amine
1-methoxy-3-(propylamino)hexan-2-one;propan-1-amine (PubChem CID 91209575) has the molecular formula C13H30N2O2
and a molecular weight of 246.39 g/mol. Its IUPAC name is 1-methoxy-3-(propylamino)hexan-2-one;propan-1-amine.
Molecular Properties
| Compound Name | 1-methoxy-3-(propylamino)hexan-2-one;propan-1-amine |
| PubChem CID | 91209575 |
| Molecular Formula | C13H30N2O2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 1-methoxy-3-(propylamino)hexan-2-one;propan-1-amine |
| SMILES | CCCN.CCCNC(CCC)C(=O)COC |
| InChI | InChI=1S/C10H21NO2.C3H9N/c1-4-6-9(11-7-5-2)10(12)8-13-3;1-2-3-4/h9,11H,4-8H2,1-3H3;2-4H2,1H3 |
| InChIKey | UCTSVRRZUWUEBR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methoxy-3-(propylamino)hexan-2-one;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3-(propylamino)hexan-2-one;propan-1-amine?
The IUPAC name of 1-methoxy-3-(propylamino)hexan-2-one;propan-1-amine (CID 91209575) is 1-methoxy-3-(propylamino)hexan-2-one;propan-1-amine.
What is the SMILES notation for 1-methoxy-3-(propylamino)hexan-2-one;propan-1-amine?
The canonical SMILES for 1-methoxy-3-(propylamino)hexan-2-one;propan-1-amine is CCCN.CCCNC(CCC)C(=O)COC.
What is the InChIKey of 1-methoxy-3-(propylamino)hexan-2-one;propan-1-amine?
The InChIKey is UCTSVRRZUWUEBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2.C3H9N/c1-4-6-9(11-7-5-2)10(12)8-13-3;1-2-3-4/h9,11H,4-8H2,1-3H3;2-4H2,1H3.
What are the key properties of 1-methoxy-3-(propylamino)hexan-2-one;propan-1-amine?
1-methoxy-3-(propylamino)hexan-2-one;propan-1-amine has a molecular weight of 246.39 g/mol, XLogP of 1.73, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3-(propylamino)hexan-2-one;propan-1-amine is sourced from PubChem (CID 91209575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).