C26H28FN3O5S2 — CID 91209661
N-[3-[(1R,8S)-3-[(4-fluorophenyl)methyl]-6-oxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-2H-1λ6,4-benzothiazin-7-yl]methanesulfonamide (PubChem CID 91209661) has the molecular formula C26H28FN3O5S2 and a molecular weight of 545.66 g/mol. Its IUPAC name is N-[3-[(1R,8S)-3-[(4-fluorophenyl)methyl]-6-oxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-2H-1λ6,4-benzothiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-[(1R,8S)-3-[(4-fluorophenyl)methyl]-6-oxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-2H-1λ6,4-benzothiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 91209661 |
| Molecular Formula | C26H28FN3O5S2 |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | N-[3-[(1R,8S)-3-[(4-fluorophenyl)methyl]-6-oxo-3-azatricyclo[6.2.1.02,7]undecan-5-yl]-1,1-dioxo-2H-1λ6,4-benzothiazin-7-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)S(=O)(=O)CC(C1CN(Cc3ccc(F)cc3)C3C(C1=O)[C@H]1CC[C@@H]3C1)=N2 |
| InChI | InChI=1S/C26H28FN3O5S2/c1-36(32,33)29-19-8-9-21-23(11-19)37(34,35)14-22(28-21)20-13-30(12-15-2-6-18(27)7-3-15)25-17-5-4-16(10-17)24(25)26(20)31/h2-3,6-9,11,16-17,20,24-25,29H,4-5,10,12-14H2,1H3/t16-,17+,20?,24?,25?/m0/s1 |
| InChIKey | CPJPIPJQXCMUDW-APCVPOLFSA-N |
| XLogP | 3.17 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |