C19H18F2N2O2 — CID 91209816
6-(difluoromethoxy)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)isoindol-1-ol (PubChem CID 91209816) has the molecular formula C19H18F2N2O2 and a molecular weight of 344.36 g/mol. Its IUPAC name is 6-(difluoromethoxy)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)isoindol-1-ol.
| Compound Name | 6-(difluoromethoxy)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)isoindol-1-ol |
|---|---|
| PubChem CID | 91209816 |
| Molecular Formula | C19H18F2N2O2 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 6-(difluoromethoxy)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)isoindol-1-ol |
| SMILES | CN1CCCc2cc(-n3cc4ccc(OC(F)F)cc4c3O)ccc21 |
| InChI | InChI=1S/C19H18F2N2O2/c1-22-8-2-3-12-9-14(5-7-17(12)22)23-11-13-4-6-15(25-19(20)21)10-16(13)18(23)24/h4-7,9-11,19,24H,2-3,8H2,1H3 |
| InChIKey | MKZGFWXOYWGVTN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|