C5H8F9NO3S — CID 91209824
2-fluorosulfanyl-4-(methylamino)-4-oxobutanoic acid;molecular fluorine (PubChem CID 91209824) has the molecular formula C5H8F9NO3S and a molecular weight of 333.17 g/mol. Its IUPAC name is 2-fluorosulfanyl-4-(methylamino)-4-oxobutanoic acid;molecular fluorine.
| Compound Name | 2-fluorosulfanyl-4-(methylamino)-4-oxobutanoic acid;molecular fluorine |
|---|---|
| PubChem CID | 91209824 |
| Molecular Formula | C5H8F9NO3S |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 2-fluorosulfanyl-4-(methylamino)-4-oxobutanoic acid;molecular fluorine |
| SMILES | CNC(=O)CC(SF)C(=O)O.FF.FF.FF.FF |
| InChI | InChI=1S/C5H8FNO3S.4F2/c1-7-4(8)2-3(11-6)5(9)10;4*1-2/h3H,2H2,1H3,(H,7,8)(H,9,10);;;; |
| InChIKey | OZXCLEBEVHEEBF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |