About 2-trimethylsilyloxyethyl 2-methyl-6-trimethylsilyloxyhex-2-enoate
2-trimethylsilyloxyethyl 2-methyl-6-trimethylsilyloxyhex-2-enoate (PubChem CID 91209829) has the molecular formula C15H32O4Si2
and a molecular weight of 332.59 g/mol. Its IUPAC name is 2-trimethylsilyloxyethyl 2-methyl-6-trimethylsilyloxyhex-2-enoate.
Molecular Properties
| Compound Name | 2-trimethylsilyloxyethyl 2-methyl-6-trimethylsilyloxyhex-2-enoate |
| PubChem CID | 91209829 |
| Molecular Formula | C15H32O4Si2 |
| Molecular Weight | 332.59 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2-trimethylsilyloxyethyl 2-methyl-6-trimethylsilyloxyhex-2-enoate |
| SMILES | CC(=CCCCO[Si](C)(C)C)C(=O)OCCO[Si](C)(C)C |
| InChI | InChI=1S/C15H32O4Si2/c1-14(10-8-9-11-18-20(2,3)4)15(16)17-12-13-19-21(5,6)7/h10H,8-9,11-13H2,1-7H3 |
| InChIKey | SQIDWMKQXSSPQE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilyloxyethyl 2-methyl-6-trimethylsilyloxyhex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilyloxyethyl 2-methyl-6-trimethylsilyloxyhex-2-enoate?
The IUPAC name of 2-trimethylsilyloxyethyl 2-methyl-6-trimethylsilyloxyhex-2-enoate (CID 91209829) is 2-trimethylsilyloxyethyl 2-methyl-6-trimethylsilyloxyhex-2-enoate.
What is the SMILES notation for 2-trimethylsilyloxyethyl 2-methyl-6-trimethylsilyloxyhex-2-enoate?
The canonical SMILES for 2-trimethylsilyloxyethyl 2-methyl-6-trimethylsilyloxyhex-2-enoate is CC(=CCCCO[Si](C)(C)C)C(=O)OCCO[Si](C)(C)C.
What is the InChIKey of 2-trimethylsilyloxyethyl 2-methyl-6-trimethylsilyloxyhex-2-enoate?
The InChIKey is SQIDWMKQXSSPQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O4Si2/c1-14(10-8-9-11-18-20(2,3)4)15(16)17-12-13-19-21(5,6)7/h10H,8-9,11-13H2,1-7H3.
What are the key properties of 2-trimethylsilyloxyethyl 2-methyl-6-trimethylsilyloxyhex-2-enoate?
2-trimethylsilyloxyethyl 2-methyl-6-trimethylsilyloxyhex-2-enoate has a molecular weight of 332.59 g/mol, XLogP of 3.96, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilyloxyethyl 2-methyl-6-trimethylsilyloxyhex-2-enoate is sourced from PubChem (CID 91209829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).