C9H11F7O — CID 91209906
3-ethyl-4,4,5,5,6,6,6-heptafluoro-1-methoxyhex-2-ene (PubChem CID 91209906) has the molecular formula C9H11F7O and a molecular weight of 268.17 g/mol. Its IUPAC name is 3-ethyl-4,4,5,5,6,6,6-heptafluoro-1-methoxyhex-2-ene.
| Compound Name | 3-ethyl-4,4,5,5,6,6,6-heptafluoro-1-methoxyhex-2-ene |
|---|---|
| PubChem CID | 91209906 |
| Molecular Formula | C9H11F7O |
| Molecular Weight | 268.17 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 3-ethyl-4,4,5,5,6,6,6-heptafluoro-1-methoxyhex-2-ene |
| SMILES | CCC(=CCOC)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F7O/c1-3-6(4-5-17-2)7(10,11)8(12,13)9(14,15)16/h4H,3,5H2,1-2H3 |
| InChIKey | FXZYWYIXQJZMIW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.17 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|