C22H30N2O4 — CID 91209924
tert-butyl 4-[2-[(2,5-dimethylphenyl)methylidene]-3-oxobutanoyl]piperazine-1-carboxylate (PubChem CID 91209924) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is tert-butyl 4-[2-[(2,5-dimethylphenyl)methylidene]-3-oxobutanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(2,5-dimethylphenyl)methylidene]-3-oxobutanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91209924 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | tert-butyl 4-[2-[(2,5-dimethylphenyl)methylidene]-3-oxobutanoyl]piperazine-1-carboxylate |
| SMILES | CC(=O)C(=Cc1cc(C)ccc1C)C(=O)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H30N2O4/c1-15-7-8-16(2)18(13-15)14-19(17(3)25)20(26)23-9-11-24(12-10-23)21(27)28-22(4,5)6/h7-8,13-14H,9-12H2,1-6H3 |
| InChIKey | KOXXSHQOMOHDJQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|