C5H6N5S+ — CID 91210059
5-(1H-1,2,4-triazol-2-ium-2-ylmethyl)-1,2,4-thiadiazole (PubChem CID 91210059) has the molecular formula C5H6N5S+ and a molecular weight of 168.21 g/mol. Its IUPAC name is 5-(1H-1,2,4-triazol-2-ium-2-ylmethyl)-1,2,4-thiadiazole.
| Compound Name | 5-(1H-1,2,4-triazol-2-ium-2-ylmethyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 91210059 |
| Molecular Formula | C5H6N5S+ |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | 5-(1H-1,2,4-triazol-2-ium-2-ylmethyl)-1,2,4-thiadiazole |
| SMILES | c1nsc(C[n+]2cnc[nH]2)n1 |
| InChI | InChI=1S/C5H5N5S/c1(5-7-3-9-11-5)10-4-6-2-8-10/h2-4H,1H2/p+1 |
| InChIKey | UTABSXIMOMKKLG-UHFFFAOYSA-O |
| XLogP | -0.40 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|