C17H17BrN2O3S — CID 9121006
4-bromo-N-[(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]benzenesulfonamide (PubChem CID 9121006) has the molecular formula C17H17BrN2O3S and a molecular weight of 409.31 g/mol. Its IUPAC name is 4-bromo-N-[(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]benzenesulfonamide.
| Compound Name | 4-bromo-N-[(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 9121006 |
| Molecular Formula | C17H17BrN2O3S |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 4-bromo-N-[(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]benzenesulfonamide |
| SMILES | COc1ccc2c(c1)CCCC2=NNS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H17BrN2O3S/c1-23-14-7-10-16-12(11-14)3-2-4-17(16)19-20-24(21,22)15-8-5-13(18)6-9-15/h5-11,20H,2-4H2,1H3 |
| InChIKey | NQWQLLQUTDJSKZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|