C27H30F2O3 — CID 91210080
2-[4-[4-(1,1-difluoroethyl)phenyl]-2,6-dimethylphenyl]-4-(oxan-4-ylmethyl)cyclopentane-1,3-dione (PubChem CID 91210080) has the molecular formula C27H30F2O3 and a molecular weight of 440.53 g/mol. Its IUPAC name is 2-[4-[4-(1,1-difluoroethyl)phenyl]-2,6-dimethylphenyl]-4-(oxan-4-ylmethyl)cyclopentane-1,3-dione.
| Compound Name | 2-[4-[4-(1,1-difluoroethyl)phenyl]-2,6-dimethylphenyl]-4-(oxan-4-ylmethyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 91210080 |
| Molecular Formula | C27H30F2O3 |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-[4-[4-(1,1-difluoroethyl)phenyl]-2,6-dimethylphenyl]-4-(oxan-4-ylmethyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(-c2ccc(C(C)(F)F)cc2)cc(C)c1C1C(=O)CC(CC2CCOCC2)C1=O |
| InChI | InChI=1S/C27H30F2O3/c1-16-12-20(19-4-6-22(7-5-19)27(3,28)29)13-17(2)24(16)25-23(30)15-21(26(25)31)14-18-8-10-32-11-9-18/h4-7,12-13,18,21,25H,8-11,14-15H2,1-3H3 |
| InChIKey | QGKOTLQGPMVHBC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|