C7H6F2N2O — CID 91210667
3-(4,4-difluoro-3-oxobut-1-enyl)iminopropanenitrile (PubChem CID 91210667) has the molecular formula C7H6F2N2O and a molecular weight of 172.13 g/mol. Its IUPAC name is 3-(4,4-difluoro-3-oxobut-1-enyl)iminopropanenitrile.
| Compound Name | 3-(4,4-difluoro-3-oxobut-1-enyl)iminopropanenitrile |
|---|---|
| PubChem CID | 91210667 |
| Molecular Formula | C7H6F2N2O |
| Molecular Weight | 172.13 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 3-(4,4-difluoro-3-oxobut-1-enyl)iminopropanenitrile |
| SMILES | N#CC/C=N/C=CC(=O)C(F)F |
| InChI | InChI=1S/C7H6F2N2O/c8-7(9)6(12)2-5-11-4-1-3-10/h2,4-5,7H,1H2/b5-2?,11-4+ |
| InChIKey | RHMBTPHMFZHKEX-NHQWWQOCSA-N |
| XLogP | 1.32 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.13 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|