About N-amino-N-(5-methyl-1,2-oxazol-4-yl)formamide
N-amino-N-(5-methyl-1,2-oxazol-4-yl)formamide (PubChem CID 91210915) has the molecular formula C5H7N3O2
and a molecular weight of 141.13 g/mol. Its IUPAC name is N-amino-N-(5-methyl-1,2-oxazol-4-yl)formamide.
Molecular Properties
| Compound Name | N-amino-N-(5-methyl-1,2-oxazol-4-yl)formamide |
| PubChem CID | 91210915 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | N-amino-N-(5-methyl-1,2-oxazol-4-yl)formamide |
| SMILES | Cc1oncc1N(N)C=O |
| InChI | InChI=1S/C5H7N3O2/c1-4-5(2-7-10-4)8(6)3-9/h2-3H,6H2,1H3 |
| InChIKey | QZKPKJLHHONEKV-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N-(5-methyl-1,2-oxazol-4-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N-(5-methyl-1,2-oxazol-4-yl)formamide?
The IUPAC name of N-amino-N-(5-methyl-1,2-oxazol-4-yl)formamide (CID 91210915) is N-amino-N-(5-methyl-1,2-oxazol-4-yl)formamide.
What is the SMILES notation for N-amino-N-(5-methyl-1,2-oxazol-4-yl)formamide?
The canonical SMILES for N-amino-N-(5-methyl-1,2-oxazol-4-yl)formamide is Cc1oncc1N(N)C=O.
What is the InChIKey of N-amino-N-(5-methyl-1,2-oxazol-4-yl)formamide?
The InChIKey is QZKPKJLHHONEKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2/c1-4-5(2-7-10-4)8(6)3-9/h2-3H,6H2,1H3.
What are the key properties of N-amino-N-(5-methyl-1,2-oxazol-4-yl)formamide?
N-amino-N-(5-methyl-1,2-oxazol-4-yl)formamide has a molecular weight of 141.13 g/mol, XLogP of -0.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N-(5-methyl-1,2-oxazol-4-yl)formamide is sourced from PubChem (CID 91210915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).