C23H29N5O2 — CID 9121111
2-(benzimidazol-1-yl)-N-[(Z)-1-[3-(diethylaminomethyl)-4-methoxyphenyl]ethylideneamino]acetamide (PubChem CID 9121111) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-(benzimidazol-1-yl)-N-[(Z)-1-[3-(diethylaminomethyl)-4-methoxyphenyl]ethylideneamino]acetamide.
| Compound Name | 2-(benzimidazol-1-yl)-N-[(Z)-1-[3-(diethylaminomethyl)-4-methoxyphenyl]ethylideneamino]acetamide |
|---|---|
| PubChem CID | 9121111 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 2-(benzimidazol-1-yl)-N-[(Z)-1-[3-(diethylaminomethyl)-4-methoxyphenyl]ethylideneamino]acetamide |
| SMILES | CCN(CC)Cc1cc(/C(C)=N\NC(=O)Cn2cnc3ccccc32)ccc1OC |
| InChI | InChI=1S/C23H29N5O2/c1-5-27(6-2)14-19-13-18(11-12-22(19)30-4)17(3)25-26-23(29)15-28-16-24-20-9-7-8-10-21(20)28/h7-13,16H,5-6,14-15H2,1-4H3,(H,26,29)/b25-17- |
| InChIKey | OTDJUKMOZLHXSR-UQQQWYQISA-N |
| XLogP | 3.43 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|