About 2-fluoro-4-hexyl-1,3-oxazole
2-fluoro-4-hexyl-1,3-oxazole (PubChem CID 91211469) has the molecular formula C9H14FNO
and a molecular weight of 171.22 g/mol. Its IUPAC name is 2-fluoro-4-hexyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-fluoro-4-hexyl-1,3-oxazole |
| PubChem CID | 91211469 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 2-fluoro-4-hexyl-1,3-oxazole |
| SMILES | CCCCCCc1coc(F)n1 |
| InChI | InChI=1S/C9H14FNO/c1-2-3-4-5-6-8-7-12-9(10)11-8/h7H,2-6H2,1H3 |
| InChIKey | QLYSCLFBLXJDTR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-hexyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-hexyl-1,3-oxazole?
The IUPAC name of 2-fluoro-4-hexyl-1,3-oxazole (CID 91211469) is 2-fluoro-4-hexyl-1,3-oxazole.
What is the SMILES notation for 2-fluoro-4-hexyl-1,3-oxazole?
The canonical SMILES for 2-fluoro-4-hexyl-1,3-oxazole is CCCCCCc1coc(F)n1.
What is the InChIKey of 2-fluoro-4-hexyl-1,3-oxazole?
The InChIKey is QLYSCLFBLXJDTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FNO/c1-2-3-4-5-6-8-7-12-9(10)11-8/h7H,2-6H2,1H3.
What are the key properties of 2-fluoro-4-hexyl-1,3-oxazole?
2-fluoro-4-hexyl-1,3-oxazole has a molecular weight of 171.22 g/mol, XLogP of 2.94, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-hexyl-1,3-oxazole is sourced from PubChem (CID 91211469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).