C22H17N5O2 — CID 91211531
1-[[4-(3-methyl-5-oxo-1H-pyrazol-2-yl)phenyl]iminomethyl]-1,3-dihydropyrrolo[3,2-f]quinolin-2-one (PubChem CID 91211531) has the molecular formula C22H17N5O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 1-[[4-(3-methyl-5-oxo-1H-pyrazol-2-yl)phenyl]iminomethyl]-1,3-dihydropyrrolo[3,2-f]quinolin-2-one.
| Compound Name | 1-[[4-(3-methyl-5-oxo-1H-pyrazol-2-yl)phenyl]iminomethyl]-1,3-dihydropyrrolo[3,2-f]quinolin-2-one |
|---|---|
| PubChem CID | 91211531 |
| Molecular Formula | C22H17N5O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 1-[[4-(3-methyl-5-oxo-1H-pyrazol-2-yl)phenyl]iminomethyl]-1,3-dihydropyrrolo[3,2-f]quinolin-2-one |
| SMILES | Cc1cc(=O)[nH]n1-c1ccc(/N=C/C2C(=O)Nc3ccc4ncccc4c32)cc1 |
| InChI | InChI=1S/C22H17N5O2/c1-13-11-20(28)26-27(13)15-6-4-14(5-7-15)24-12-17-21-16-3-2-10-23-18(16)8-9-19(21)25-22(17)29/h2-12,17H,1H3,(H,25,29)(H,26,28)/b24-12+ |
| InChIKey | ZOOVUJCEJJQIIS-WYMPLXKRSA-N |
| XLogP | 3.46 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|