C43H36F3N2O3P+2 — CID 91211856
3-(4-diphenylphosphorylphenyl)-8-methyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-[4-(trifluoromethyl)phenyl]-2H-1,3-benzoxazin-3-ium (PubChem CID 91211856) has the molecular formula C43H36F3N2O3P+2 and a molecular weight of 716.74 g/mol. Its IUPAC name is 3-(4-diphenylphosphorylphenyl)-8-methyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-[4-(trifluoromethyl)phenyl]-2H-1,3-benzoxazin-3-ium.
| Compound Name | 3-(4-diphenylphosphorylphenyl)-8-methyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-[4-(trifluoromethyl)phenyl]-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 91211856 |
| Molecular Formula | C43H36F3N2O3P+2 |
| Molecular Weight | 716.74 g/mol |
| Exact Mass | 716.24 |
| IUPAC Name | 3-(4-diphenylphosphorylphenyl)-8-methyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-[4-(trifluoromethyl)phenyl]-2H-1,3-benzoxazin-3-ium |
| SMILES | Cc1cccc2c1OC[N+](c1ccc(C(F)(F)F)cc1)=C2.Cc1cccc2c1OC[N+](c1ccc(P(=O)(c3ccccc3)c3ccccc3)cc1)=C2 |
| InChI | InChI=1S/C27H23NO2P.C16H13F3NO/c1-21-9-8-10-22-19-28(20-30-27(21)22)23-15-17-26(18-16-23)31(29,24-11-4-2-5-12-24)25-13-6-3-7-14-25;1-11-3-2-4-12-9-20(10-21-15(11)12)14-7-5-13(6-8-14)16(17,18)19/h2-19H,20H2,1H3;2-9H,10H2,1H3/q2*+1 |
| InChIKey | FNYIHAZISVYVGS-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 41.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.74 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|