C9H13F10NO — CID 91212069
1,3-difluoropropane;2-ethoxy-N,1,1,2,2-pentafluoro-N-(1,1,2-trifluoroethyl)ethanamine (PubChem CID 91212069) has the molecular formula C9H13F10NO and a molecular weight of 341.19 g/mol. Its IUPAC name is 1,3-difluoropropane;2-ethoxy-N,1,1,2,2-pentafluoro-N-(1,1,2-trifluoroethyl)ethanamine.
| Compound Name | 1,3-difluoropropane;2-ethoxy-N,1,1,2,2-pentafluoro-N-(1,1,2-trifluoroethyl)ethanamine |
|---|---|
| PubChem CID | 91212069 |
| Molecular Formula | C9H13F10NO |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 1,3-difluoropropane;2-ethoxy-N,1,1,2,2-pentafluoro-N-(1,1,2-trifluoroethyl)ethanamine |
| SMILES | CCOC(F)(F)C(F)(F)N(F)C(F)(F)CF.FCCCF |
| InChI | InChI=1S/C6H7F8NO.C3H6F2/c1-2-16-6(12,13)5(10,11)15(14)4(8,9)3-7;4-2-1-3-5/h2-3H2,1H3;1-3H2 |
| InChIKey | YWHUECFNHDAPBD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|