C11H9F13O2 — CID 91212367
bis(1,1-difluoroethene);1,1,1,2,3,3-hexafluoro-3-methoxy-2-(1,1,2-trifluoroprop-2-enoxy)propane (PubChem CID 91212367) has the molecular formula C11H9F13O2 and a molecular weight of 420.17 g/mol. Its IUPAC name is bis(1,1-difluoroethene);1,1,1,2,3,3-hexafluoro-3-methoxy-2-(1,1,2-trifluoroprop-2-enoxy)propane.
| Compound Name | bis(1,1-difluoroethene);1,1,1,2,3,3-hexafluoro-3-methoxy-2-(1,1,2-trifluoroprop-2-enoxy)propane |
|---|---|
| PubChem CID | 91212367 |
| Molecular Formula | C11H9F13O2 |
| Molecular Weight | 420.17 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | bis(1,1-difluoroethene);1,1,1,2,3,3-hexafluoro-3-methoxy-2-(1,1,2-trifluoroprop-2-enoxy)propane |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC.C=C(F)F.C=C(F)F |
| InChI | InChI=1S/C7H5F9O2.2C2H2F2/c1-3(8)4(9,10)18-5(11,6(12,13)14)7(15,16)17-2;2*1-2(3)4/h1H2,2H3;2*1H2 |
| InChIKey | ISXSRBPMNATZAB-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.17 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |