About 4-(2-chlorophenyl)-5-(4-chlorophenyl)-1,3-dimethyl-4H-pyridazine
4-(2-chlorophenyl)-5-(4-chlorophenyl)-1,3-dimethyl-4H-pyridazine (PubChem CID 91212747) has the molecular formula C18H16Cl2N2
and a molecular weight of 331.25 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-5-(4-chlorophenyl)-1,3-dimethyl-4H-pyridazine.
Molecular Properties
| Compound Name | 4-(2-chlorophenyl)-5-(4-chlorophenyl)-1,3-dimethyl-4H-pyridazine |
| PubChem CID | 91212747 |
| Molecular Formula | C18H16Cl2N2 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 4-(2-chlorophenyl)-5-(4-chlorophenyl)-1,3-dimethyl-4H-pyridazine |
| SMILES | CC1=NN(C)C=C(c2ccc(Cl)cc2)C1c1ccccc1Cl |
| InChI | InChI=1S/C18H16Cl2N2/c1-12-18(15-5-3-4-6-17(15)20)16(11-22(2)21-12)13-7-9-14(19)10-8-13/h3-11,18H,1-2H3 |
| InChIKey | GTLWFENLINQPHZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-chlorophenyl)-5-(4-chlorophenyl)-1,3-dimethyl-4H-pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chlorophenyl)-5-(4-chlorophenyl)-1,3-dimethyl-4H-pyridazine?
The IUPAC name of 4-(2-chlorophenyl)-5-(4-chlorophenyl)-1,3-dimethyl-4H-pyridazine (CID 91212747) is 4-(2-chlorophenyl)-5-(4-chlorophenyl)-1,3-dimethyl-4H-pyridazine.
What is the SMILES notation for 4-(2-chlorophenyl)-5-(4-chlorophenyl)-1,3-dimethyl-4H-pyridazine?
The canonical SMILES for 4-(2-chlorophenyl)-5-(4-chlorophenyl)-1,3-dimethyl-4H-pyridazine is CC1=NN(C)C=C(c2ccc(Cl)cc2)C1c1ccccc1Cl.
What is the InChIKey of 4-(2-chlorophenyl)-5-(4-chlorophenyl)-1,3-dimethyl-4H-pyridazine?
The InChIKey is GTLWFENLINQPHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Cl2N2/c1-12-18(15-5-3-4-6-17(15)20)16(11-22(2)21-12)13-7-9-14(19)10-8-13/h3-11,18H,1-2H3.
What are the key properties of 4-(2-chlorophenyl)-5-(4-chlorophenyl)-1,3-dimethyl-4H-pyridazine?
4-(2-chlorophenyl)-5-(4-chlorophenyl)-1,3-dimethyl-4H-pyridazine has a molecular weight of 331.25 g/mol, XLogP of 5.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chlorophenyl)-5-(4-chlorophenyl)-1,3-dimethyl-4H-pyridazine is sourced from PubChem (CID 91212747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).