C28H32FN7O6 — CID 91212798
1'-[2-(dimethylamino)-2-oxoacetyl]-N-[[4-fluoro-2-(5-methyl-1,2,4-triazol-1-yl)phenyl]methyl]-7,8-dioxospiro[3,4,5,9-tetrahydropyrido[2,1-c][1,4]oxazepine-10,4'-piperidine]-9-carboxamide (PubChem CID 91212798) has the molecular formula C28H32FN7O6 and a molecular weight of 581.61 g/mol. Its IUPAC name is 1'-[2-(dimethylamino)-2-oxoacetyl]-N-[[4-fluoro-2-(5-methyl-1,2,4-triazol-1-yl)phenyl]methyl]-7,8-dioxospiro[3,4,5,9-tetrahydropyrido[2,1-c][1,4]oxazepine-10,4'-piperidine]-9-carboxamide.
| Compound Name | 1'-[2-(dimethylamino)-2-oxoacetyl]-N-[[4-fluoro-2-(5-methyl-1,2,4-triazol-1-yl)phenyl]methyl]-7,8-dioxospiro[3,4,5,9-tetrahydropyrido[2,1-c][1,4]oxazepine-10,4'-piperidine]-9-carboxamide |
|---|---|
| PubChem CID | 91212798 |
| Molecular Formula | C28H32FN7O6 |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | 1'-[2-(dimethylamino)-2-oxoacetyl]-N-[[4-fluoro-2-(5-methyl-1,2,4-triazol-1-yl)phenyl]methyl]-7,8-dioxospiro[3,4,5,9-tetrahydropyrido[2,1-c][1,4]oxazepine-10,4'-piperidine]-9-carboxamide |
| SMILES | Cc1ncnn1-c1cc(F)ccc1CNC(=O)C1C(=O)C(=O)N2CCCOC=C2C12CCN(C(=O)C(=O)N(C)C)CC2 |
| InChI | InChI=1S/C28H32FN7O6/c1-17-31-16-32-36(17)20-13-19(29)6-5-18(20)14-30-24(38)22-23(37)25(39)35-9-4-12-42-15-21(35)28(22)7-10-34(11-8-28)27(41)26(40)33(2)3/h5-6,13,15-16,22H,4,7-12,14H2,1-3H3,(H,30,38) |
| InChIKey | DXUYWJZJJIRRTH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|