C18H32N2O2 — CID 91212833
2,2-dimethyl-7-(methylamino)-1-(4-methyl-3,4-dihydro-2H-pyrrol-5-yl)decane-1,8-dione (PubChem CID 91212833) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 2,2-dimethyl-7-(methylamino)-1-(4-methyl-3,4-dihydro-2H-pyrrol-5-yl)decane-1,8-dione.
| Compound Name | 2,2-dimethyl-7-(methylamino)-1-(4-methyl-3,4-dihydro-2H-pyrrol-5-yl)decane-1,8-dione |
|---|---|
| PubChem CID | 91212833 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 2,2-dimethyl-7-(methylamino)-1-(4-methyl-3,4-dihydro-2H-pyrrol-5-yl)decane-1,8-dione |
| SMILES | CCC(=O)C(CCCCC(C)(C)C(=O)C1=NCCC1C)NC |
| InChI | InChI=1S/C18H32N2O2/c1-6-15(21)14(19-5)9-7-8-11-18(3,4)17(22)16-13(2)10-12-20-16/h13-14,19H,6-12H2,1-5H3 |
| InChIKey | QIRJMXIPICNDRU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|