C12H15Cl3N2O8 — CID 91213667
2-[carboxymethyl-[2-(2,2,3-trichloro-5,9-dioxo-1,4,7-dioxazonan-7-yl)ethyl]amino]acetic acid (PubChem CID 91213667) has the molecular formula C12H15Cl3N2O8 and a molecular weight of 421.62 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-(2,2,3-trichloro-5,9-dioxo-1,4,7-dioxazonan-7-yl)ethyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-(2,2,3-trichloro-5,9-dioxo-1,4,7-dioxazonan-7-yl)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 91213667 |
| Molecular Formula | C12H15Cl3N2O8 |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 2-[carboxymethyl-[2-(2,2,3-trichloro-5,9-dioxo-1,4,7-dioxazonan-7-yl)ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN1CC(=O)OC(Cl)C(Cl)(Cl)OC(=O)C1)CC(=O)O |
| InChI | InChI=1S/C12H15Cl3N2O8/c13-11-12(14,15)25-10(23)6-17(5-9(22)24-11)2-1-16(3-7(18)19)4-8(20)21/h11H,1-6H2,(H,18,19)(H,20,21) |
| InChIKey | YAJKBDUXOKIBST-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|