C14H18N2O4S — CID 91213748
5-[(7S)-7-ethyl-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-2H-1,2,5-thiadiazol-3-ol (PubChem CID 91213748) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 5-[(7S)-7-ethyl-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-2H-1,2,5-thiadiazol-3-ol.
| Compound Name | 5-[(7S)-7-ethyl-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-2H-1,2,5-thiadiazol-3-ol |
|---|---|
| PubChem CID | 91213748 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 5-[(7S)-7-ethyl-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-2H-1,2,5-thiadiazol-3-ol |
| SMILES | CC[C@H]1CCc2cc(O)c(N3C=C(O)NS3(=O)=O)cc2C1 |
| InChI | InChI=1S/C14H18N2O4S/c1-2-9-3-4-10-7-13(17)12(6-11(10)5-9)16-8-14(18)15-21(16,19)20/h6-9,15,17-18H,2-5H2,1H3/t9-/m0/s1 |
| InChIKey | RFZZQMKSUXRMDU-VIFPVBQESA-N |
| XLogP | 1.92 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |