C18H15N5O — CID 9121431
N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(2-methylbenzimidazol-1-yl)acetamide (PubChem CID 9121431) has the molecular formula C18H15N5O and a molecular weight of 317.35 g/mol. Its IUPAC name is N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(2-methylbenzimidazol-1-yl)acetamide.
| Compound Name | N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(2-methylbenzimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 9121431 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-[(Z)-(4-cyanophenyl)methylideneamino]-2-(2-methylbenzimidazol-1-yl)acetamide |
| SMILES | Cc1nc2ccccc2n1CC(=O)N/N=C\c1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H15N5O/c1-13-21-16-4-2-3-5-17(16)23(13)12-18(24)22-20-11-15-8-6-14(10-19)7-9-15/h2-9,11H,12H2,1H3,(H,22,24)/b20-11- |
| InChIKey | WHJSGXFLHOXWLC-JAIQZWGSSA-N |
| XLogP | 2.37 |
| TPSA | 83.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|