C10H10ClN3 — CID 91214432
3-chloro-6-propan-2-yl-1,2,4-benzotriazine (PubChem CID 91214432) has the molecular formula C10H10ClN3 and a molecular weight of 207.66 g/mol. Its IUPAC name is 3-chloro-6-propan-2-yl-1,2,4-benzotriazine.
| Compound Name | 3-chloro-6-propan-2-yl-1,2,4-benzotriazine |
|---|---|
| PubChem CID | 91214432 |
| Molecular Formula | C10H10ClN3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 3-chloro-6-propan-2-yl-1,2,4-benzotriazine |
| SMILES | CC(C)c1ccc2nnc(Cl)nc2c1 |
| InChI | InChI=1S/C10H10ClN3/c1-6(2)7-3-4-8-9(5-7)12-10(11)14-13-8/h3-6H,1-2H3 |
| InChIKey | ZRNBCIZKMVRAOW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |