C37H45N3O2 — CID 91214464
(3aS,3bS,9aR,9bR,11aS)-5,6,9a,11a-tetramethyl-7-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide (PubChem CID 91214464) has the molecular formula C37H45N3O2 and a molecular weight of 563.79 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aS)-5,6,9a,11a-tetramethyl-7-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide.
| Compound Name | (3aS,3bS,9aR,9bR,11aS)-5,6,9a,11a-tetramethyl-7-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 91214464 |
| Molecular Formula | C37H45N3O2 |
| Molecular Weight | 563.79 g/mol |
| Exact Mass | 563.35 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aS)-5,6,9a,11a-tetramethyl-7-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-8-carboxamide |
| SMILES | CC1=C2N(C)C(=O)C(C(=O)NCCc3c(-c4ccccc4)[nH]c4ccccc34)C[C@]2(C)[C@@H]2CC[C@]3(C)CCC[C@H]3[C@@H]2C1 |
| InChI | InChI=1S/C37H45N3O2/c1-23-21-27-29-14-10-18-36(29,2)19-16-30(27)37(3)22-28(35(42)40(4)33(23)37)34(41)38-20-17-26-25-13-8-9-15-31(25)39-32(26)24-11-6-5-7-12-24/h5-9,11-13,15,27-30,39H,10,14,16-22H2,1-4H3,(H,38,41)/t27-,28?,29-,30+,36-,37+/m0/s1 |
| InChIKey | RXUNWNOQQUMESH-VNKZKVOJSA-N |
| XLogP | 7.49 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.79 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|