C20H24N2 — CID 91214634
(2R,3R)-1-naphthalen-1-yl-1,2,3,4,4a,5,6,7-octahydronaphthalene-2,3-diamine (PubChem CID 91214634) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is (2R,3R)-1-naphthalen-1-yl-1,2,3,4,4a,5,6,7-octahydronaphthalene-2,3-diamine.
| Compound Name | (2R,3R)-1-naphthalen-1-yl-1,2,3,4,4a,5,6,7-octahydronaphthalene-2,3-diamine |
|---|---|
| PubChem CID | 91214634 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (2R,3R)-1-naphthalen-1-yl-1,2,3,4,4a,5,6,7-octahydronaphthalene-2,3-diamine |
| SMILES | N[C@@H]1CC2CCCC=C2C(c2cccc3ccccc23)[C@H]1N |
| InChI | InChI=1S/C20H24N2/c21-18-12-14-7-2-4-10-16(14)19(20(18)22)17-11-5-8-13-6-1-3-9-15(13)17/h1,3,5-6,8-11,14,18-20H,2,4,7,12,21-22H2/t14?,18-,19?,20+/m1/s1 |
| InChIKey | FLVITTFKFQKCMO-DVMGTHGPSA-N |
| XLogP | 3.71 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|