C43H81NO2 — CID 91214824
1-[2-(14-butyl-15-methylnonadeca-9,12-dienyl)-2-dodec-9-enyl-1,3-dioxan-5-yl]-N,N-dimethylmethanamine (PubChem CID 91214824) has the molecular formula C43H81NO2 and a molecular weight of 644.13 g/mol. Its IUPAC name is 1-[2-(14-butyl-15-methylnonadeca-9,12-dienyl)-2-dodec-9-enyl-1,3-dioxan-5-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-(14-butyl-15-methylnonadeca-9,12-dienyl)-2-dodec-9-enyl-1,3-dioxan-5-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 91214824 |
| Molecular Formula | C43H81NO2 |
| Molecular Weight | 644.13 g/mol |
| Exact Mass | 643.63 |
| IUPAC Name | 1-[2-(14-butyl-15-methylnonadeca-9,12-dienyl)-2-dodec-9-enyl-1,3-dioxan-5-yl]-N,N-dimethylmethanamine |
| SMILES | CCC=CCCCCCCCCC1(CCCCCCCCC=CCC=CC(CCCC)C(C)CCCC)OCC(CN(C)C)CO1 |
| InChI | InChI=1S/C43H81NO2/c1-7-10-13-14-15-16-21-24-27-30-35-43(45-38-41(39-46-43)37-44(5)6)36-31-28-25-22-19-17-18-20-23-26-29-34-42(33-12-9-3)40(4)32-11-8-2/h10,13,20,23,29,34,40-42H,7-9,11-12,14-19,21-22,24-28,30-33,35-39H2,1-6H3 |
| InChIKey | HLRGPHJVHDUOER-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.13 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|