C19H38N2 — CID 91215496
3-N-(2,4-dimethylpentyl)-6,6,7,7-tetramethyloctane-3,4-diimine (PubChem CID 91215496) has the molecular formula C19H38N2 and a molecular weight of 294.53 g/mol. Its IUPAC name is 3-N-(2,4-dimethylpentyl)-6,6,7,7-tetramethyloctane-3,4-diimine.
| Compound Name | 3-N-(2,4-dimethylpentyl)-6,6,7,7-tetramethyloctane-3,4-diimine |
|---|---|
| PubChem CID | 91215496 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | 3-N-(2,4-dimethylpentyl)-6,6,7,7-tetramethyloctane-3,4-diimine |
| SMILES | [H]/N=C(CC(C)(C)C(C)(C)C)\C(CC)=N\CC(C)CC(C)C |
| InChI | InChI=1S/C19H38N2/c1-10-17(21-13-15(4)11-14(2)3)16(20)12-19(8,9)18(5,6)7/h14-15,20H,10-13H2,1-9H3/b20-16-,21-17+ |
| InChIKey | IJNILKIINZAVMA-ARHRGINZSA-N |
| XLogP | 6.00 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|