C17H35NO2S — CID 91215584
2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide (PubChem CID 91215584) has the molecular formula C17H35NO2S and a molecular weight of 317.54 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide.
| Compound Name | 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide |
|---|---|
| PubChem CID | 91215584 |
| Molecular Formula | C17H35NO2S |
| Molecular Weight | 317.54 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide |
| SMILES | CCSCC(=O)NCCCOC(C)(C)CCC(C)C(C)C |
| InChI | InChI=1S/C17H35NO2S/c1-7-21-13-16(19)18-11-8-12-20-17(5,6)10-9-15(4)14(2)3/h14-15H,7-13H2,1-6H3,(H,18,19) |
| InChIKey | CGTHGWVCAMQQKM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|