About 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide
2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide (PubChem CID 91215584) has the molecular formula C17H35NO2S
and a molecular weight of 317.54 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide.
Molecular Properties
| Compound Name | 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide |
| PubChem CID | 91215584 |
| Molecular Formula | C17H35NO2S |
| Molecular Weight | 317.54 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide |
| SMILES | CCSCC(=O)NCCCOC(C)(C)CCC(C)C(C)C |
| InChI | InChI=1S/C17H35NO2S/c1-7-21-13-16(19)18-11-8-12-20-17(5,6)10-9-15(4)14(2)3/h14-15H,7-13H2,1-6H3,(H,18,19) |
| InChIKey | CGTHGWVCAMQQKM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide?
The IUPAC name of 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide (CID 91215584) is 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide.
What is the SMILES notation for 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide?
The canonical SMILES for 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide is CCSCC(=O)NCCCOC(C)(C)CCC(C)C(C)C.
What is the InChIKey of 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide?
The InChIKey is CGTHGWVCAMQQKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO2S/c1-7-21-13-16(19)18-11-8-12-20-17(5,6)10-9-15(4)14(2)3/h14-15H,7-13H2,1-6H3,(H,18,19).
What are the key properties of 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide?
2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide has a molecular weight of 317.54 g/mol, XLogP of 4.11, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanyl-N-[3-(2,5,6-trimethylheptan-2-yloxy)propyl]acetamide is sourced from PubChem (CID 91215584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).