About 2-(ethynylamino)acetic acid
2-(ethynylamino)acetic acid (PubChem CID 91216343) has the molecular formula C4H5NO2
and a molecular weight of 99.09 g/mol. Its IUPAC name is 2-(ethynylamino)acetic acid.
Molecular Properties
| Compound Name | 2-(ethynylamino)acetic acid |
| PubChem CID | 91216343 |
| Molecular Formula | C4H5NO2 |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.03 |
| IUPAC Name | 2-(ethynylamino)acetic acid |
| SMILES | C#CNCC(=O)O |
| InChI | InChI=1S/C4H5NO2/c1-2-5-3-4(6)7/h1,5H,3H2,(H,6,7) |
| InChIKey | ANXDEIFQHQXTFG-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(ethynylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethynylamino)acetic acid?
The IUPAC name of 2-(ethynylamino)acetic acid (CID 91216343) is 2-(ethynylamino)acetic acid.
What is the SMILES notation for 2-(ethynylamino)acetic acid?
The canonical SMILES for 2-(ethynylamino)acetic acid is C#CNCC(=O)O.
What is the InChIKey of 2-(ethynylamino)acetic acid?
The InChIKey is ANXDEIFQHQXTFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2/c1-2-5-3-4(6)7/h1,5H,3H2,(H,6,7).
What are the key properties of 2-(ethynylamino)acetic acid?
2-(ethynylamino)acetic acid has a molecular weight of 99.09 g/mol, XLogP of -0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethynylamino)acetic acid is sourced from PubChem (CID 91216343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).