C32H54 — CID 91217083
2,6,10,15,19,23,24-heptamethylpentacosa-2,6,10,14,18,22-hexaene (PubChem CID 91217083) has the molecular formula C32H54 and a molecular weight of 438.78 g/mol. Its IUPAC name is 2,6,10,15,19,23,24-heptamethylpentacosa-2,6,10,14,18,22-hexaene.
| Compound Name | 2,6,10,15,19,23,24-heptamethylpentacosa-2,6,10,14,18,22-hexaene |
|---|---|
| PubChem CID | 91217083 |
| Molecular Formula | C32H54 |
| Molecular Weight | 438.78 g/mol |
| Exact Mass | 438.42 |
| IUPAC Name | 2,6,10,15,19,23,24-heptamethylpentacosa-2,6,10,14,18,22-hexaene |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C(C)C |
| InChI | InChI=1S/C32H54/c1-26(2)16-12-19-30(7)22-13-20-28(5)17-10-11-18-29(6)21-14-23-31(8)24-15-25-32(9)27(3)4/h16-18,22-23,25,27H,10-15,19-21,24H2,1-9H3 |
| InChIKey | ZZCFZSRQBIPQAH-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.78 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|