C15H21N3 — CID 9121718
N-[(E)-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylidene]amino]pyridin-2-amine (PubChem CID 9121718) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-[(E)-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylidene]amino]pyridin-2-amine.
| Compound Name | N-[(E)-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylidene]amino]pyridin-2-amine |
|---|---|
| PubChem CID | 9121718 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N-[(E)-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylidene]amino]pyridin-2-amine |
| SMILES | c1ccc(N/N=C2\CC[C@@H]3CCCC[C@@H]3C2)nc1 |
| InChI | InChI=1S/C15H21N3/c1-2-6-13-11-14(9-8-12(13)5-1)17-18-15-7-3-4-10-16-15/h3-4,7,10,12-13H,1-2,5-6,8-9,11H2,(H,16,18)/b17-14+/t12-,13+/m0/s1 |
| InChIKey | ZWWDKRWBBAERAV-MFXGOXFXSA-N |
| XLogP | 3.84 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|