C24H25ClFN3O4S — CID 91217227
[(3-chloro-4-fluorobenzoyl)-[4-[(4-methylquinolin-2-yl)amino]cyclohexyl]amino]methanesulfonic acid (PubChem CID 91217227) has the molecular formula C24H25ClFN3O4S and a molecular weight of 506.00 g/mol. Its IUPAC name is [(3-chloro-4-fluorobenzoyl)-[4-[(4-methylquinolin-2-yl)amino]cyclohexyl]amino]methanesulfonic acid.
| Compound Name | [(3-chloro-4-fluorobenzoyl)-[4-[(4-methylquinolin-2-yl)amino]cyclohexyl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 91217227 |
| Molecular Formula | C24H25ClFN3O4S |
| Molecular Weight | 506.00 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | [(3-chloro-4-fluorobenzoyl)-[4-[(4-methylquinolin-2-yl)amino]cyclohexyl]amino]methanesulfonic acid |
| SMILES | Cc1cc(NC2CCC(N(CS(=O)(=O)O)C(=O)c3ccc(F)c(Cl)c3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H25ClFN3O4S/c1-15-12-23(28-22-5-3-2-4-19(15)22)27-17-7-9-18(10-8-17)29(14-34(31,32)33)24(30)16-6-11-21(26)20(25)13-16/h2-6,11-13,17-18H,7-10,14H2,1H3,(H,27,28)(H,31,32,33) |
| InChIKey | LQHPJVJRPUQWAW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.00 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|