C14H19I2N — CID 91217400
ethane;molecular iodine;2,3,4,5-tetrahydro-1H-indeno[1,2-c]pyridine (PubChem CID 91217400) has the molecular formula C14H19I2N and a molecular weight of 455.12 g/mol. Its IUPAC name is ethane;molecular iodine;2,3,4,5-tetrahydro-1H-indeno[1,2-c]pyridine.
| Compound Name | ethane;molecular iodine;2,3,4,5-tetrahydro-1H-indeno[1,2-c]pyridine |
|---|---|
| PubChem CID | 91217400 |
| Molecular Formula | C14H19I2N |
| Molecular Weight | 455.12 g/mol |
| Exact Mass | 454.96 |
| IUPAC Name | ethane;molecular iodine;2,3,4,5-tetrahydro-1H-indeno[1,2-c]pyridine |
| SMILES | CC.II.c1ccc2c(c1)CC1=C2CNCC1 |
| InChI | InChI=1S/C12H13N.C2H6.I2/c1-2-4-11-9(3-1)7-10-5-6-13-8-12(10)11;2*1-2/h1-4,13H,5-8H2;1-2H3; |
| InChIKey | WKNSMPNZPNJPAN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.12 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|